C27H36F2O — CID 145346141
4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-1-methyl-1-pentylcycloheptane (PubChem CID 145346141) has the molecular formula C27H36F2O and a molecular weight of 414.58 g/mol. Its IUPAC name is 4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-1-methyl-1-pentylcycloheptane.
| Compound Name | 4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-1-methyl-1-pentylcycloheptane |
|---|---|
| PubChem CID | 145346141 |
| Molecular Formula | C27H36F2O |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | 4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-1-methyl-1-pentylcycloheptane |
| SMILES | CCCCCC1(C)CCCC(c2ccc(-c3ccc(OCC)c(F)c3F)cc2)CC1 |
| InChI | InChI=1S/C27H36F2O/c1-4-6-7-17-27(3)18-8-9-20(16-19-27)21-10-12-22(13-11-21)23-14-15-24(30-5-2)26(29)25(23)28/h10-15,20H,4-9,16-19H2,1-3H3 |
| InChIKey | UHYJTQBHQHJWNO-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|