C18H24F2O2 — CID 122479941
5-[2-(4-ethoxy-2,3-difluorophenyl)ethyl]-2-propyl-3,6-dihydro-2H-pyran (PubChem CID 122479941) has the molecular formula C18H24F2O2 and a molecular weight of 310.38 g/mol. Its IUPAC name is 5-[2-(4-ethoxy-2,3-difluorophenyl)ethyl]-2-propyl-3,6-dihydro-2H-pyran.
| Compound Name | 5-[2-(4-ethoxy-2,3-difluorophenyl)ethyl]-2-propyl-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 122479941 |
| Molecular Formula | C18H24F2O2 |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 5-[2-(4-ethoxy-2,3-difluorophenyl)ethyl]-2-propyl-3,6-dihydro-2H-pyran |
| SMILES | CCCC1CC=C(CCc2ccc(OCC)c(F)c2F)CO1 |
| InChI | InChI=1S/C18H24F2O2/c1-3-5-15-10-7-13(12-22-15)6-8-14-9-11-16(21-4-2)18(20)17(14)19/h7,9,11,15H,3-6,8,10,12H2,1-2H3 |
| InChIKey | IDPHZHCOCIUJSJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|