C20H28F4O — CID 58953172
1-ethoxy-2-fluoro-4-[2-(4-propylcyclohexyl)ethyl]-3-(trifluoromethyl)benzene (PubChem CID 58953172) has the molecular formula C20H28F4O and a molecular weight of 360.44 g/mol. Its IUPAC name is 1-ethoxy-2-fluoro-4-[2-(4-propylcyclohexyl)ethyl]-3-(trifluoromethyl)benzene.
| Compound Name | 1-ethoxy-2-fluoro-4-[2-(4-propylcyclohexyl)ethyl]-3-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 58953172 |
| Molecular Formula | C20H28F4O |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | 1-ethoxy-2-fluoro-4-[2-(4-propylcyclohexyl)ethyl]-3-(trifluoromethyl)benzene |
| SMILES | CCCC1CCC(CCc2ccc(OCC)c(F)c2C(F)(F)F)CC1 |
| InChI | InChI=1S/C20H28F4O/c1-3-5-14-6-8-15(9-7-14)10-11-16-12-13-17(25-4-2)19(21)18(16)20(22,23)24/h12-15H,3-11H2,1-2H3 |
| InChIKey | GAZJDHSYWJUUFH-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |