C30H44F4O — CID 58953457
1-ethoxy-2-fluoro-4-[2-[4-[(E)-2-(4-pentylcyclohexyl)ethenyl]cyclohexyl]ethyl]-3-(trifluoromethyl)benzene (PubChem CID 58953457) has the molecular formula C30H44F4O and a molecular weight of 496.67 g/mol. Its IUPAC name is 1-ethoxy-2-fluoro-4-[2-[4-[(E)-2-(4-pentylcyclohexyl)ethenyl]cyclohexyl]ethyl]-3-(trifluoromethyl)benzene.
| Compound Name | 1-ethoxy-2-fluoro-4-[2-[4-[(E)-2-(4-pentylcyclohexyl)ethenyl]cyclohexyl]ethyl]-3-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 58953457 |
| Molecular Formula | C30H44F4O |
| Molecular Weight | 496.67 g/mol |
| Exact Mass | 496.33 |
| IUPAC Name | 1-ethoxy-2-fluoro-4-[2-[4-[(E)-2-(4-pentylcyclohexyl)ethenyl]cyclohexyl]ethyl]-3-(trifluoromethyl)benzene |
| SMILES | CCCCCC1CCC(/C=C/C2CCC(CCc3ccc(OCC)c(F)c3C(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C30H44F4O/c1-3-5-6-7-22-8-10-23(11-9-22)12-13-24-14-16-25(17-15-24)18-19-26-20-21-27(35-4-2)29(31)28(26)30(32,33)34/h12-13,20-25H,3-11,14-19H2,1-2H3/b13-12+ |
| InChIKey | SOBNZIQJMMDYIR-OUKQBFOZSA-N |
| XLogP | 9.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.67 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|