C29H44F4O — CID 59592268
1-ethoxy-2-fluoro-5-methyl-4-[2-[4-(4-pentylcyclohexyl)cyclohexyl]ethyl]-3-(trifluoromethyl)benzene (PubChem CID 59592268) has the molecular formula C29H44F4O and a molecular weight of 484.66 g/mol. Its IUPAC name is 1-ethoxy-2-fluoro-5-methyl-4-[2-[4-(4-pentylcyclohexyl)cyclohexyl]ethyl]-3-(trifluoromethyl)benzene.
| Compound Name | 1-ethoxy-2-fluoro-5-methyl-4-[2-[4-(4-pentylcyclohexyl)cyclohexyl]ethyl]-3-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 59592268 |
| Molecular Formula | C29H44F4O |
| Molecular Weight | 484.66 g/mol |
| Exact Mass | 484.33 |
| IUPAC Name | 1-ethoxy-2-fluoro-5-methyl-4-[2-[4-(4-pentylcyclohexyl)cyclohexyl]ethyl]-3-(trifluoromethyl)benzene |
| SMILES | CCCCCC1CCC(C2CCC(CCc3c(C)cc(OCC)c(F)c3C(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C29H44F4O/c1-4-6-7-8-21-9-14-23(15-10-21)24-16-11-22(12-17-24)13-18-25-20(3)19-26(34-5-2)28(30)27(25)29(31,32)33/h19,21-24H,4-18H2,1-3H3 |
| InChIKey | YSZRTZBQAHXOQI-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.66 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|