C21H30F2O — CID 59592372
1-butoxy-4-[2-(4-ethenylcyclohexyl)ethyl]-2,3-difluoro-5-methylbenzene (PubChem CID 59592372) has the molecular formula C21H30F2O and a molecular weight of 336.47 g/mol. Its IUPAC name is 1-butoxy-4-[2-(4-ethenylcyclohexyl)ethyl]-2,3-difluoro-5-methylbenzene.
| Compound Name | 1-butoxy-4-[2-(4-ethenylcyclohexyl)ethyl]-2,3-difluoro-5-methylbenzene |
|---|---|
| PubChem CID | 59592372 |
| Molecular Formula | C21H30F2O |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 1-butoxy-4-[2-(4-ethenylcyclohexyl)ethyl]-2,3-difluoro-5-methylbenzene |
| SMILES | C=CC1CCC(CCc2c(C)cc(OCCCC)c(F)c2F)CC1 |
| InChI | InChI=1S/C21H30F2O/c1-4-6-13-24-19-14-15(3)18(20(22)21(19)23)12-11-17-9-7-16(5-2)8-10-17/h5,14,16-17H,2,4,6-13H2,1,3H3 |
| InChIKey | UHSYRUTXAIRETF-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|