C22H30F2O3 — CID 59795268
6-[2-(4-ethenylcyclohexyl)oxyethoxy]-7,8-difluoro-2-propyl-3,4-dihydro-2H-chromene (PubChem CID 59795268) has the molecular formula C22H30F2O3 and a molecular weight of 380.48 g/mol. Its IUPAC name is 6-[2-(4-ethenylcyclohexyl)oxyethoxy]-7,8-difluoro-2-propyl-3,4-dihydro-2H-chromene.
| Compound Name | 6-[2-(4-ethenylcyclohexyl)oxyethoxy]-7,8-difluoro-2-propyl-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 59795268 |
| Molecular Formula | C22H30F2O3 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 6-[2-(4-ethenylcyclohexyl)oxyethoxy]-7,8-difluoro-2-propyl-3,4-dihydro-2H-chromene |
| SMILES | C=CC1CCC(OCCOc2cc3c(c(F)c2F)OC(CCC)CC3)CC1 |
| InChI | InChI=1S/C22H30F2O3/c1-3-5-18-11-8-16-14-19(20(23)21(24)22(16)27-18)26-13-12-25-17-9-6-15(4-2)7-10-17/h4,14-15,17-18H,2-3,5-13H2,1H3 |
| InChIKey | UCTMZWATGPYBHZ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|