C23H31F2IO2 — CID 90278325
7,8-difluoro-6-[[4-(4-iodocyclohexyl)cyclohexyl]methoxy]-2-methyl-3,4-dihydro-2H-chromene (PubChem CID 90278325) has the molecular formula C23H31F2IO2 and a molecular weight of 504.40 g/mol. Its IUPAC name is 7,8-difluoro-6-[[4-(4-iodocyclohexyl)cyclohexyl]methoxy]-2-methyl-3,4-dihydro-2H-chromene.
| Compound Name | 7,8-difluoro-6-[[4-(4-iodocyclohexyl)cyclohexyl]methoxy]-2-methyl-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 90278325 |
| Molecular Formula | C23H31F2IO2 |
| Molecular Weight | 504.40 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | 7,8-difluoro-6-[[4-(4-iodocyclohexyl)cyclohexyl]methoxy]-2-methyl-3,4-dihydro-2H-chromene |
| SMILES | CC1CCc2cc(OCC3CCC(C4CCC(I)CC4)CC3)c(F)c(F)c2O1 |
| InChI | InChI=1S/C23H31F2IO2/c1-14-2-5-18-12-20(21(24)22(25)23(18)28-14)27-13-15-3-6-16(7-4-15)17-8-10-19(26)11-9-17/h12,14-17,19H,2-11,13H2,1H3 |
| InChIKey | XMEHHDZEYWSMTQ-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.40 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|