C26H38F2O — CID 173390288
4-but-3-enyl-2,3-difluoro-1-methoxy-5-[4-(4-propylcyclohexyl)cyclohexyl]benzene (PubChem CID 173390288) has the molecular formula C26H38F2O and a molecular weight of 404.59 g/mol. Its IUPAC name is 4-but-3-enyl-2,3-difluoro-1-methoxy-5-[4-(4-propylcyclohexyl)cyclohexyl]benzene.
| Compound Name | 4-but-3-enyl-2,3-difluoro-1-methoxy-5-[4-(4-propylcyclohexyl)cyclohexyl]benzene |
|---|---|
| PubChem CID | 173390288 |
| Molecular Formula | C26H38F2O |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | 4-but-3-enyl-2,3-difluoro-1-methoxy-5-[4-(4-propylcyclohexyl)cyclohexyl]benzene |
| SMILES | C=CCCc1c(C2CCC(C3CCC(CCC)CC3)CC2)cc(OC)c(F)c1F |
| InChI | InChI=1S/C26H38F2O/c1-4-6-8-22-23(17-24(29-3)26(28)25(22)27)21-15-13-20(14-16-21)19-11-9-18(7-5-2)10-12-19/h4,17-21H,1,5-16H2,2-3H3 |
| InChIKey | AYZCQZUZCCBFGA-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|