C20H31FO — CID 59592310
5-ethoxy-1-fluoro-3-methyl-2-[2-(4-propylcyclohexyl)ethyl]benzene (PubChem CID 59592310) has the molecular formula C20H31FO and a molecular weight of 306.47 g/mol. Its IUPAC name is 5-ethoxy-1-fluoro-3-methyl-2-[2-(4-propylcyclohexyl)ethyl]benzene.
| Compound Name | 5-ethoxy-1-fluoro-3-methyl-2-[2-(4-propylcyclohexyl)ethyl]benzene |
|---|---|
| PubChem CID | 59592310 |
| Molecular Formula | C20H31FO |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.24 |
| IUPAC Name | 5-ethoxy-1-fluoro-3-methyl-2-[2-(4-propylcyclohexyl)ethyl]benzene |
| SMILES | CCCC1CCC(CCc2c(C)cc(OCC)cc2F)CC1 |
| InChI | InChI=1S/C20H31FO/c1-4-6-16-7-9-17(10-8-16)11-12-19-15(3)13-18(22-5-2)14-20(19)21/h13-14,16-17H,4-12H2,1-3H3 |
| InChIKey | QKZRURXTWJCNSO-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |