C19H29FO — CID 118312086
1-ethoxy-2-ethyl-3-fluoro-4-(4-propylcyclohexyl)benzene (PubChem CID 118312086) has the molecular formula C19H29FO and a molecular weight of 292.44 g/mol. Its IUPAC name is 1-ethoxy-2-ethyl-3-fluoro-4-(4-propylcyclohexyl)benzene.
| Compound Name | 1-ethoxy-2-ethyl-3-fluoro-4-(4-propylcyclohexyl)benzene |
|---|---|
| PubChem CID | 118312086 |
| Molecular Formula | C19H29FO |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 1-ethoxy-2-ethyl-3-fluoro-4-(4-propylcyclohexyl)benzene |
| SMILES | CCCC1CCC(c2ccc(OCC)c(CC)c2F)CC1 |
| InChI | InChI=1S/C19H29FO/c1-4-7-14-8-10-15(11-9-14)17-12-13-18(21-6-3)16(5-2)19(17)20/h12-15H,4-11H2,1-3H3 |
| InChIKey | YKAOKRCIFFNRIS-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |