C21H30ClF2OSi — CID 19428880
CID 19428880 (PubChem CID 19428880) has the molecular formula C21H30ClF2OSi and a molecular weight of 400.01 g/mol.
| Compound Name | CID 19428880 |
|---|---|
| PubChem CID | 19428880 |
| Molecular Formula | C21H30ClF2OSi |
| Molecular Weight | 400.01 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | — |
| SMILES | CCOc1ccc(C2CCC(CCC3CC[Si](Cl)CC3)CC2)c(F)c1F |
| InChI | InChI=1S/C21H30ClF2OSi/c1-2-25-19-10-9-18(20(23)21(19)24)17-7-5-15(6-8-17)3-4-16-11-13-26(22)14-12-16/h9-10,15-17H,2-8,11-14H2,1H3 |
| InChIKey | KHFXEDHTSVZLFG-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.01 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|