C28H27F6NO2 — CID 162009998
4-[[4-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]cyclohexyl]methoxy]-2,3-difluoro-N-methylaniline (PubChem CID 162009998) has the molecular formula C28H27F6NO2 and a molecular weight of 523.52 g/mol. Its IUPAC name is 4-[[4-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]cyclohexyl]methoxy]-2,3-difluoro-N-methylaniline.
| Compound Name | 4-[[4-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]cyclohexyl]methoxy]-2,3-difluoro-N-methylaniline |
|---|---|
| PubChem CID | 162009998 |
| Molecular Formula | C28H27F6NO2 |
| Molecular Weight | 523.52 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | 4-[[4-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]cyclohexyl]methoxy]-2,3-difluoro-N-methylaniline |
| SMILES | CCOc1ccc(-c2ccc(C3CCC(COc4ccc(NC)c(F)c4F)CC3)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C28H27F6NO2/c1-3-36-21-12-10-19(25(31)27(21)33)18-9-8-17(23(29)24(18)30)16-6-4-15(5-7-16)14-37-22-13-11-20(35-2)26(32)28(22)34/h8-13,15-16,35H,3-7,14H2,1-2H3 |
| InChIKey | YTIOVKSNHKVMRK-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.52 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|