C28H24F6O3 — CID 88967541
2-[4-[4-[[4-(2,3-difluoro-4-methoxyphenyl)cyclohexyl]methoxy]-2,3-difluorophenyl]-2,3-difluorophenyl]oxirane (PubChem CID 88967541) has the molecular formula C28H24F6O3 and a molecular weight of 522.49 g/mol. Its IUPAC name is 2-[4-[4-[[4-(2,3-difluoro-4-methoxyphenyl)cyclohexyl]methoxy]-2,3-difluorophenyl]-2,3-difluorophenyl]oxirane.
| Compound Name | 2-[4-[4-[[4-(2,3-difluoro-4-methoxyphenyl)cyclohexyl]methoxy]-2,3-difluorophenyl]-2,3-difluorophenyl]oxirane |
|---|---|
| PubChem CID | 88967541 |
| Molecular Formula | C28H24F6O3 |
| Molecular Weight | 522.49 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | 2-[4-[4-[[4-(2,3-difluoro-4-methoxyphenyl)cyclohexyl]methoxy]-2,3-difluorophenyl]-2,3-difluorophenyl]oxirane |
| SMILES | COc1ccc(C2CCC(COc3ccc(-c4ccc(C5CO5)c(F)c4F)c(F)c3F)CC2)c(F)c1F |
| InChI | InChI=1S/C28H24F6O3/c1-35-20-10-8-16(23(29)27(20)33)15-4-2-14(3-5-15)12-36-21-11-9-18(25(31)28(21)34)17-6-7-19(22-13-37-22)26(32)24(17)30/h6-11,14-15,22H,2-5,12-13H2,1H3 |
| InChIKey | ORNPAOKJZXMLQO-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.49 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|