C29H32F4O2 — CID 88957907
2-[4-[4-[[4-(4-ethenylcyclohexyl)cyclohexyl]methoxy]-2,3-difluorophenyl]-2,3-difluorophenyl]oxirane (PubChem CID 88957907) has the molecular formula C29H32F4O2 and a molecular weight of 488.57 g/mol. Its IUPAC name is 2-[4-[4-[[4-(4-ethenylcyclohexyl)cyclohexyl]methoxy]-2,3-difluorophenyl]-2,3-difluorophenyl]oxirane.
| Compound Name | 2-[4-[4-[[4-(4-ethenylcyclohexyl)cyclohexyl]methoxy]-2,3-difluorophenyl]-2,3-difluorophenyl]oxirane |
|---|---|
| PubChem CID | 88957907 |
| Molecular Formula | C29H32F4O2 |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | 2-[4-[4-[[4-(4-ethenylcyclohexyl)cyclohexyl]methoxy]-2,3-difluorophenyl]-2,3-difluorophenyl]oxirane |
| SMILES | C=CC1CCC(C2CCC(COc3ccc(-c4ccc(C5CO5)c(F)c4F)c(F)c3F)CC2)CC1 |
| InChI | InChI=1S/C29H32F4O2/c1-2-17-3-7-19(8-4-17)20-9-5-18(6-10-20)15-34-24-14-13-22(27(31)29(24)33)21-11-12-23(25-16-35-25)28(32)26(21)30/h2,11-14,17-20,25H,1,3-10,15-16H2 |
| InChIKey | PXPRJVHTYYZVAT-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|