C30H44F2O3 — CID 154607221
5-(4-butoxy-2,3-difluorophenyl)-2-[[4-(4-ethenylcyclohexyl)cyclohexyl]methoxy]oxane (PubChem CID 154607221) has the molecular formula C30H44F2O3 and a molecular weight of 490.68 g/mol. Its IUPAC name is 5-(4-butoxy-2,3-difluorophenyl)-2-[[4-(4-ethenylcyclohexyl)cyclohexyl]methoxy]oxane.
| Compound Name | 5-(4-butoxy-2,3-difluorophenyl)-2-[[4-(4-ethenylcyclohexyl)cyclohexyl]methoxy]oxane |
|---|---|
| PubChem CID | 154607221 |
| Molecular Formula | C30H44F2O3 |
| Molecular Weight | 490.68 g/mol |
| Exact Mass | 490.33 |
| IUPAC Name | 5-(4-butoxy-2,3-difluorophenyl)-2-[[4-(4-ethenylcyclohexyl)cyclohexyl]methoxy]oxane |
| SMILES | C=CC1CCC(C2CCC(COC3CCC(c4ccc(OCCCC)c(F)c4F)CO3)CC2)CC1 |
| InChI | InChI=1S/C30H44F2O3/c1-3-5-18-33-27-16-15-26(29(31)30(27)32)25-14-17-28(35-20-25)34-19-22-8-12-24(13-9-22)23-10-6-21(4-2)7-11-23/h4,15-16,21-25,28H,2-3,5-14,17-20H2,1H3 |
| InChIKey | OUAKGRRFIQJQIL-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.68 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|