C27H38F2O2 — CID 58021262
5-(4-ethenylcyclohexyl)-2-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]oxane (PubChem CID 58021262) has the molecular formula C27H38F2O2 and a molecular weight of 432.60 g/mol. Its IUPAC name is 5-(4-ethenylcyclohexyl)-2-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]oxane.
| Compound Name | 5-(4-ethenylcyclohexyl)-2-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]oxane |
|---|---|
| PubChem CID | 58021262 |
| Molecular Formula | C27H38F2O2 |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.28 |
| IUPAC Name | 5-(4-ethenylcyclohexyl)-2-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]oxane |
| SMILES | C=CC1CCC(C2CCC(C3CCC(c4ccc(OCC)c(F)c4F)CC3)OC2)CC1 |
| InChI | InChI=1S/C27H38F2O2/c1-3-18-5-7-19(8-6-18)22-13-15-24(31-17-22)21-11-9-20(10-12-21)23-14-16-25(30-4-2)27(29)26(23)28/h3,14,16,18-22,24H,1,4-13,15,17H2,2H3 |
| InChIKey | CUXOGULICWSGPR-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|