C17H20F2O — CID 163533849
1-(4-ethenylcyclohexyl)-2,3-difluoro-4-prop-2-enoxybenzene (PubChem CID 163533849) has the molecular formula C17H20F2O and a molecular weight of 278.34 g/mol. Its IUPAC name is 1-(4-ethenylcyclohexyl)-2,3-difluoro-4-prop-2-enoxybenzene.
| Compound Name | 1-(4-ethenylcyclohexyl)-2,3-difluoro-4-prop-2-enoxybenzene |
|---|---|
| PubChem CID | 163533849 |
| Molecular Formula | C17H20F2O |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 1-(4-ethenylcyclohexyl)-2,3-difluoro-4-prop-2-enoxybenzene |
| SMILES | C=CCOc1ccc(C2CCC(C=C)CC2)c(F)c1F |
| InChI | InChI=1S/C17H20F2O/c1-3-11-20-15-10-9-14(16(18)17(15)19)13-7-5-12(4-2)6-8-13/h3-4,9-10,12-13H,1-2,5-8,11H2 |
| InChIKey | DVGYUUIFICGKBW-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|