C23H32F2O — CID 126759194
1-[4-(4,4-dimethylcyclohexyl)cyclohexyl]-2,3-difluoro-4-prop-2-enoxybenzene (PubChem CID 126759194) has the molecular formula C23H32F2O and a molecular weight of 362.50 g/mol. Its IUPAC name is 1-[4-(4,4-dimethylcyclohexyl)cyclohexyl]-2,3-difluoro-4-prop-2-enoxybenzene.
| Compound Name | 1-[4-(4,4-dimethylcyclohexyl)cyclohexyl]-2,3-difluoro-4-prop-2-enoxybenzene |
|---|---|
| PubChem CID | 126759194 |
| Molecular Formula | C23H32F2O |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | 1-[4-(4,4-dimethylcyclohexyl)cyclohexyl]-2,3-difluoro-4-prop-2-enoxybenzene |
| SMILES | C=CCOc1ccc(C2CCC(C3CCC(C)(C)CC3)CC2)c(F)c1F |
| InChI | InChI=1S/C23H32F2O/c1-4-15-26-20-10-9-19(21(24)22(20)25)18-7-5-16(6-8-18)17-11-13-23(2,3)14-12-17/h4,9-10,16-18H,1,5-8,11-15H2,2-3H3 |
| InChIKey | NJUYPXRJHKNHOF-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|