C22H29F3O3 — CID 118593950
2-[4-(2,3-difluoro-4-prop-2-enoxyphenyl)cyclohexyl]-5-fluoro-5-propyl-1,3-dioxane (PubChem CID 118593950) has the molecular formula C22H29F3O3 and a molecular weight of 398.47 g/mol. Its IUPAC name is 2-[4-(2,3-difluoro-4-prop-2-enoxyphenyl)cyclohexyl]-5-fluoro-5-propyl-1,3-dioxane.
| Compound Name | 2-[4-(2,3-difluoro-4-prop-2-enoxyphenyl)cyclohexyl]-5-fluoro-5-propyl-1,3-dioxane |
|---|---|
| PubChem CID | 118593950 |
| Molecular Formula | C22H29F3O3 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 2-[4-(2,3-difluoro-4-prop-2-enoxyphenyl)cyclohexyl]-5-fluoro-5-propyl-1,3-dioxane |
| SMILES | C=CCOc1ccc(C2CCC(C3OCC(F)(CCC)CO3)CC2)c(F)c1F |
| InChI | InChI=1S/C22H29F3O3/c1-3-11-22(25)13-27-21(28-14-22)16-7-5-15(6-8-16)17-9-10-18(26-12-4-2)20(24)19(17)23/h4,9-10,15-16,21H,2-3,5-8,11-14H2,1H3 |
| InChIKey | LACHKHVCHQVJKE-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|