C31H43F3O2 — CID 123490034
2-[4-[2-[4-(4-but-3-enyl-2,3-difluorophenyl)cyclohexyl]ethenyl]cyclohexyl]-5-fluoro-5-propyl-1,3-dioxane (PubChem CID 123490034) has the molecular formula C31H43F3O2 and a molecular weight of 504.68 g/mol. Its IUPAC name is 2-[4-[2-[4-(4-but-3-enyl-2,3-difluorophenyl)cyclohexyl]ethenyl]cyclohexyl]-5-fluoro-5-propyl-1,3-dioxane.
| Compound Name | 2-[4-[2-[4-(4-but-3-enyl-2,3-difluorophenyl)cyclohexyl]ethenyl]cyclohexyl]-5-fluoro-5-propyl-1,3-dioxane |
|---|---|
| PubChem CID | 123490034 |
| Molecular Formula | C31H43F3O2 |
| Molecular Weight | 504.68 g/mol |
| Exact Mass | 504.32 |
| IUPAC Name | 2-[4-[2-[4-(4-but-3-enyl-2,3-difluorophenyl)cyclohexyl]ethenyl]cyclohexyl]-5-fluoro-5-propyl-1,3-dioxane |
| SMILES | C=CCCc1ccc(C2CCC(C=CC3CCC(C4OCC(F)(CCC)CO4)CC3)CC2)c(F)c1F |
| InChI | InChI=1S/C31H43F3O2/c1-3-5-6-25-17-18-27(29(33)28(25)32)24-13-9-22(10-14-24)7-8-23-11-15-26(16-12-23)30-35-20-31(34,19-4-2)21-36-30/h3,7-8,17-18,22-24,26,30H,1,4-6,9-16,19-21H2,2H3 |
| InChIKey | NQZCHRSZJPHJLN-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.68 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|