C18H21F5O3 — CID 118593931
2-[(4-but-3-enyl-2,3-difluorophenoxy)-difluoromethyl]-5-fluoro-5-propyl-1,3-dioxane (PubChem CID 118593931) has the molecular formula C18H21F5O3 and a molecular weight of 380.35 g/mol. Its IUPAC name is 2-[(4-but-3-enyl-2,3-difluorophenoxy)-difluoromethyl]-5-fluoro-5-propyl-1,3-dioxane.
| Compound Name | 2-[(4-but-3-enyl-2,3-difluorophenoxy)-difluoromethyl]-5-fluoro-5-propyl-1,3-dioxane |
|---|---|
| PubChem CID | 118593931 |
| Molecular Formula | C18H21F5O3 |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 2-[(4-but-3-enyl-2,3-difluorophenoxy)-difluoromethyl]-5-fluoro-5-propyl-1,3-dioxane |
| SMILES | C=CCCc1ccc(OC(F)(F)C2OCC(F)(CCC)CO2)c(F)c1F |
| InChI | InChI=1S/C18H21F5O3/c1-3-5-6-12-7-8-13(15(20)14(12)19)26-18(22,23)16-24-10-17(21,9-4-2)11-25-16/h3,7-8,16H,1,4-6,9-11H2,2H3 |
| InChIKey | PWIGUJJONWPJCU-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|