C27H24F4O2 — CID 118891252
2-[(4-but-3-enyl-2-fluorophenyl)methoxy]-3,4,5-trifluoro-6-propyl-9H-xanthene (PubChem CID 118891252) has the molecular formula C27H24F4O2 and a molecular weight of 456.48 g/mol. Its IUPAC name is 2-[(4-but-3-enyl-2-fluorophenyl)methoxy]-3,4,5-trifluoro-6-propyl-9H-xanthene.
| Compound Name | 2-[(4-but-3-enyl-2-fluorophenyl)methoxy]-3,4,5-trifluoro-6-propyl-9H-xanthene |
|---|---|
| PubChem CID | 118891252 |
| Molecular Formula | C27H24F4O2 |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 2-[(4-but-3-enyl-2-fluorophenyl)methoxy]-3,4,5-trifluoro-6-propyl-9H-xanthene |
| SMILES | C=CCCc1ccc(COc2cc3c(c(F)c2F)Oc2c(ccc(CCC)c2F)C3)c(F)c1 |
| InChI | InChI=1S/C27H24F4O2/c1-3-5-7-16-8-9-19(21(28)12-16)15-32-22-14-20-13-18-11-10-17(6-4-2)23(29)26(18)33-27(20)25(31)24(22)30/h3,8-12,14H,1,4-7,13,15H2,2H3 |
| InChIKey | JVKGVSNEEHGMOF-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|