C24H19F5O — CID 118891234
2-(2,3-difluoro-4-propylphenyl)-6-ethyl-3,4,5-trifluoro-9H-xanthene (PubChem CID 118891234) has the molecular formula C24H19F5O and a molecular weight of 418.41 g/mol. Its IUPAC name is 2-(2,3-difluoro-4-propylphenyl)-6-ethyl-3,4,5-trifluoro-9H-xanthene.
| Compound Name | 2-(2,3-difluoro-4-propylphenyl)-6-ethyl-3,4,5-trifluoro-9H-xanthene |
|---|---|
| PubChem CID | 118891234 |
| Molecular Formula | C24H19F5O |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 2-(2,3-difluoro-4-propylphenyl)-6-ethyl-3,4,5-trifluoro-9H-xanthene |
| SMILES | CCCc1ccc(-c2cc3c(c(F)c2F)Oc2c(ccc(CC)c2F)C3)c(F)c1F |
| InChI | InChI=1S/C24H19F5O/c1-3-5-13-8-9-16(20(27)18(13)25)17-11-15-10-14-7-6-12(4-2)19(26)23(14)30-24(15)22(29)21(17)28/h6-9,11H,3-5,10H2,1-2H3 |
| InChIKey | IAMMREGZJJBMDL-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |