C26H29F3O3 — CID 118891401
(3,4,5-trifluoro-6-propyl-9H-xanthen-2-yl) 4-propylcyclohexane-1-carboxylate (PubChem CID 118891401) has the molecular formula C26H29F3O3 and a molecular weight of 446.51 g/mol. Its IUPAC name is (3,4,5-trifluoro-6-propyl-9H-xanthen-2-yl) 4-propylcyclohexane-1-carboxylate.
| Compound Name | (3,4,5-trifluoro-6-propyl-9H-xanthen-2-yl) 4-propylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 118891401 |
| Molecular Formula | C26H29F3O3 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | (3,4,5-trifluoro-6-propyl-9H-xanthen-2-yl) 4-propylcyclohexane-1-carboxylate |
| SMILES | CCCc1ccc2c(c1F)Oc1c(cc(OC(=O)C3CCC(CCC)CC3)c(F)c1F)C2 |
| InChI | InChI=1S/C26H29F3O3/c1-3-5-15-7-9-17(10-8-15)26(30)31-20-14-19-13-18-12-11-16(6-4-2)21(27)24(18)32-25(19)23(29)22(20)28/h11-12,14-15,17H,3-10,13H2,1-2H3 |
| InChIKey | SZXGJRCKCWAQFN-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|