C34H52F2O2 — CID 19776135
[4-[2-(4-butylcyclohexyl)ethyl]-2,3-difluorophenyl] 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate (PubChem CID 19776135) has the molecular formula C34H52F2O2 and a molecular weight of 530.78 g/mol. Its IUPAC name is [4-[2-(4-butylcyclohexyl)ethyl]-2,3-difluorophenyl] 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate.
| Compound Name | [4-[2-(4-butylcyclohexyl)ethyl]-2,3-difluorophenyl] 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 19776135 |
| Molecular Formula | C34H52F2O2 |
| Molecular Weight | 530.78 g/mol |
| Exact Mass | 530.39 |
| IUPAC Name | [4-[2-(4-butylcyclohexyl)ethyl]-2,3-difluorophenyl] 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate |
| SMILES | CCCCC1CCC(CCc2ccc(OC(=O)C3CCC(C4CCC(CCC)CC4)CC3)c(F)c2F)CC1 |
| InChI | InChI=1S/C34H52F2O2/c1-3-5-7-25-8-10-26(11-9-25)14-17-29-22-23-31(33(36)32(29)35)38-34(37)30-20-18-28(19-21-30)27-15-12-24(6-4-2)13-16-27/h22-28,30H,3-21H2,1-2H3 |
| InChIKey | IEFXWYPFLLLPGB-UHFFFAOYSA-N |
| XLogP | 10.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.78 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|