C28H40F2O2 — CID 134387369
[2,3-difluoro-4-[2-(4-methylcyclohexyl)ethyl]phenyl] 4-cyclohexylcyclohexane-1-carboxylate (PubChem CID 134387369) has the molecular formula C28H40F2O2 and a molecular weight of 446.62 g/mol. Its IUPAC name is [2,3-difluoro-4-[2-(4-methylcyclohexyl)ethyl]phenyl] 4-cyclohexylcyclohexane-1-carboxylate.
| Compound Name | [2,3-difluoro-4-[2-(4-methylcyclohexyl)ethyl]phenyl] 4-cyclohexylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 134387369 |
| Molecular Formula | C28H40F2O2 |
| Molecular Weight | 446.62 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | [2,3-difluoro-4-[2-(4-methylcyclohexyl)ethyl]phenyl] 4-cyclohexylcyclohexane-1-carboxylate |
| SMILES | CC1CCC(CCc2ccc(OC(=O)C3CCC(C4CCCCC4)CC3)c(F)c2F)CC1 |
| InChI | InChI=1S/C28H40F2O2/c1-19-7-9-20(10-8-19)11-12-23-17-18-25(27(30)26(23)29)32-28(31)24-15-13-22(14-16-24)21-5-3-2-4-6-21/h17-22,24H,2-16H2,1H3 |
| InChIKey | PBCDZWKUEZAEMM-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.62 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|