C23H32F2O2S — CID 58299358
(2,3-difluoro-4-methylsulfanylphenyl) 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate (PubChem CID 58299358) has the molecular formula C23H32F2O2S and a molecular weight of 410.57 g/mol. Its IUPAC name is (2,3-difluoro-4-methylsulfanylphenyl) 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate.
| Compound Name | (2,3-difluoro-4-methylsulfanylphenyl) 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 58299358 |
| Molecular Formula | C23H32F2O2S |
| Molecular Weight | 410.57 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | (2,3-difluoro-4-methylsulfanylphenyl) 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate |
| SMILES | CCCC1CCC(C2CCC(C(=O)Oc3ccc(SC)c(F)c3F)CC2)CC1 |
| InChI | InChI=1S/C23H32F2O2S/c1-3-4-15-5-7-16(8-6-15)17-9-11-18(12-10-17)23(26)27-19-13-14-20(28-2)22(25)21(19)24/h13-18H,3-12H2,1-2H3 |
| InChIKey | UZRUVIFFDRYPGX-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.57 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|