C21H30F2O3 — CID 19103489
(2,3-difluoro-4-pentoxyphenyl) 4-propylcyclohexane-1-carboxylate (PubChem CID 19103489) has the molecular formula C21H30F2O3 and a molecular weight of 368.46 g/mol. Its IUPAC name is (2,3-difluoro-4-pentoxyphenyl) 4-propylcyclohexane-1-carboxylate.
| Compound Name | (2,3-difluoro-4-pentoxyphenyl) 4-propylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 19103489 |
| Molecular Formula | C21H30F2O3 |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | (2,3-difluoro-4-pentoxyphenyl) 4-propylcyclohexane-1-carboxylate |
| SMILES | CCCCCOc1ccc(OC(=O)C2CCC(CCC)CC2)c(F)c1F |
| InChI | InChI=1S/C21H30F2O3/c1-3-5-6-14-25-17-12-13-18(20(23)19(17)22)26-21(24)16-10-8-15(7-4-2)9-11-16/h12-13,15-16H,3-11,14H2,1-2H3 |
| InChIKey | PYYXRALHBCPNDD-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|