C33H46F2O3 — CID 19767216
[4-(2,3-difluoro-4-octoxyphenyl)phenyl] 4-hexylcyclohexane-1-carboxylate (PubChem CID 19767216) has the molecular formula C33H46F2O3 and a molecular weight of 528.72 g/mol. Its IUPAC name is [4-(2,3-difluoro-4-octoxyphenyl)phenyl] 4-hexylcyclohexane-1-carboxylate.
| Compound Name | [4-(2,3-difluoro-4-octoxyphenyl)phenyl] 4-hexylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 19767216 |
| Molecular Formula | C33H46F2O3 |
| Molecular Weight | 528.72 g/mol |
| Exact Mass | 528.34 |
| IUPAC Name | [4-(2,3-difluoro-4-octoxyphenyl)phenyl] 4-hexylcyclohexane-1-carboxylate |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(OC(=O)C3CCC(CCCCCC)CC3)cc2)c(F)c1F |
| InChI | InChI=1S/C33H46F2O3/c1-3-5-7-9-10-12-24-37-30-23-22-29(31(34)32(30)35)26-18-20-28(21-19-26)38-33(36)27-16-14-25(15-17-27)13-11-8-6-4-2/h18-23,25,27H,3-17,24H2,1-2H3 |
| InChIKey | PILSLLKXHHTSAW-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.72 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|