C29H40N2O3 — CID 14549103
(2,3-dicyano-4-pentoxyphenyl) 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate (PubChem CID 14549103) has the molecular formula C29H40N2O3 and a molecular weight of 464.65 g/mol. Its IUPAC name is (2,3-dicyano-4-pentoxyphenyl) 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate.
| Compound Name | (2,3-dicyano-4-pentoxyphenyl) 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 14549103 |
| Molecular Formula | C29H40N2O3 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.30 |
| IUPAC Name | (2,3-dicyano-4-pentoxyphenyl) 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate |
| SMILES | CCCCCOc1ccc(OC(=O)C2CCC(C3CCC(CCC)CC3)CC2)c(C#N)c1C#N |
| InChI | InChI=1S/C29H40N2O3/c1-3-5-6-18-33-27-16-17-28(26(20-31)25(27)19-30)34-29(32)24-14-12-23(13-15-24)22-10-8-21(7-4-2)9-11-22/h16-17,21-24H,3-15,18H2,1-2H3 |
| InChIKey | YTCFHGCNMAQSCO-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 83.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|