C33H50N2O — CID 19738927
3-[2-(4-pentylcyclohexyl)ethyl]-6-[3-(4-propylcyclohexyl)propoxy]benzene-1,2-dicarbonitrile (PubChem CID 19738927) has the molecular formula C33H50N2O and a molecular weight of 490.78 g/mol. Its IUPAC name is 3-[2-(4-pentylcyclohexyl)ethyl]-6-[3-(4-propylcyclohexyl)propoxy]benzene-1,2-dicarbonitrile.
| Compound Name | 3-[2-(4-pentylcyclohexyl)ethyl]-6-[3-(4-propylcyclohexyl)propoxy]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 19738927 |
| Molecular Formula | C33H50N2O |
| Molecular Weight | 490.78 g/mol |
| Exact Mass | 490.39 |
| IUPAC Name | 3-[2-(4-pentylcyclohexyl)ethyl]-6-[3-(4-propylcyclohexyl)propoxy]benzene-1,2-dicarbonitrile |
| SMILES | CCCCCC1CCC(CCc2ccc(OCCCC3CCC(CCC)CC3)c(C#N)c2C#N)CC1 |
| InChI | InChI=1S/C33H50N2O/c1-3-5-6-9-27-15-17-29(18-16-27)19-20-30-21-22-33(32(25-35)31(30)24-34)36-23-7-10-28-13-11-26(8-4-2)12-14-28/h21-22,26-29H,3-20,23H2,1-2H3 |
| InChIKey | JJFVHXKCYVHTKS-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.78 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|