C25H34N2O — CID 57064534
3-pentyl-6-[3-(4-propylcyclohexyl)prop-2-enoxy]benzene-1,2-dicarbonitrile (PubChem CID 57064534) has the molecular formula C25H34N2O and a molecular weight of 378.56 g/mol. Its IUPAC name is 3-pentyl-6-[3-(4-propylcyclohexyl)prop-2-enoxy]benzene-1,2-dicarbonitrile.
| Compound Name | 3-pentyl-6-[3-(4-propylcyclohexyl)prop-2-enoxy]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 57064534 |
| Molecular Formula | C25H34N2O |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.27 |
| IUPAC Name | 3-pentyl-6-[3-(4-propylcyclohexyl)prop-2-enoxy]benzene-1,2-dicarbonitrile |
| SMILES | CCCCCc1ccc(OCC=CC2CCC(CCC)CC2)c(C#N)c1C#N |
| InChI | InChI=1S/C25H34N2O/c1-3-5-6-10-22-15-16-25(24(19-27)23(22)18-26)28-17-7-9-21-13-11-20(8-4-2)12-14-21/h7,9,15-16,20-21H,3-6,8,10-14,17H2,1-2H3 |
| InChIKey | LHEBFXHUAWAPAG-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|