C28H33NO3 — CID 67946216
(4-cyanophenyl) 4-[(E)-3-(4-pentylcyclohexyl)prop-2-enoxy]benzoate (PubChem CID 67946216) has the molecular formula C28H33NO3 and a molecular weight of 431.58 g/mol. Its IUPAC name is (4-cyanophenyl) 4-[(E)-3-(4-pentylcyclohexyl)prop-2-enoxy]benzoate.
| Compound Name | (4-cyanophenyl) 4-[(E)-3-(4-pentylcyclohexyl)prop-2-enoxy]benzoate |
|---|---|
| PubChem CID | 67946216 |
| Molecular Formula | C28H33NO3 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | (4-cyanophenyl) 4-[(E)-3-(4-pentylcyclohexyl)prop-2-enoxy]benzoate |
| SMILES | CCCCCC1CCC(/C=C/COc2ccc(C(=O)Oc3ccc(C#N)cc3)cc2)CC1 |
| InChI | InChI=1S/C28H33NO3/c1-2-3-4-6-22-8-10-23(11-9-22)7-5-20-31-26-18-14-25(15-19-26)28(30)32-27-16-12-24(21-29)13-17-27/h5,7,12-19,22-23H,2-4,6,8-11,20H2,1H3/b7-5+ |
| InChIKey | FFVZTYPKJKNYLC-FNORWQNLSA-N |
| XLogP | 7.10 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|