C33H46O2 — CID 67857338
(4-pentylphenyl) 4-[(E)-4-(4-pentylcyclohexyl)but-3-enyl]benzoate (PubChem CID 67857338) has the molecular formula C33H46O2 and a molecular weight of 474.73 g/mol. Its IUPAC name is (4-pentylphenyl) 4-[(E)-4-(4-pentylcyclohexyl)but-3-enyl]benzoate.
| Compound Name | (4-pentylphenyl) 4-[(E)-4-(4-pentylcyclohexyl)but-3-enyl]benzoate |
|---|---|
| PubChem CID | 67857338 |
| Molecular Formula | C33H46O2 |
| Molecular Weight | 474.73 g/mol |
| Exact Mass | 474.35 |
| IUPAC Name | (4-pentylphenyl) 4-[(E)-4-(4-pentylcyclohexyl)but-3-enyl]benzoate |
| SMILES | CCCCCc1ccc(OC(=O)c2ccc(CC/C=C/C3CCC(CCCCC)CC3)cc2)cc1 |
| InChI | InChI=1S/C33H46O2/c1-3-5-7-11-27-15-17-28(18-16-27)13-9-10-14-29-19-23-31(24-20-29)33(34)35-32-25-21-30(22-26-32)12-8-6-4-2/h9,13,19-28H,3-8,10-12,14-18H2,1-2H3/b13-9+ |
| InChIKey | GTFTUCYBGOABBG-UKTHLTGXSA-N |
| XLogP | 9.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.73 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|