C21H31I — CID 54022036
1-iodo-4-[4-(4-pentylcyclohexyl)but-3-enyl]benzene (PubChem CID 54022036) has the molecular formula C21H31I and a molecular weight of 410.38 g/mol. Its IUPAC name is 1-iodo-4-[4-(4-pentylcyclohexyl)but-3-enyl]benzene.
| Compound Name | 1-iodo-4-[4-(4-pentylcyclohexyl)but-3-enyl]benzene |
|---|---|
| PubChem CID | 54022036 |
| Molecular Formula | C21H31I |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 1-iodo-4-[4-(4-pentylcyclohexyl)but-3-enyl]benzene |
| SMILES | CCCCCC1CCC(C=CCCc2ccc(I)cc2)CC1 |
| InChI | InChI=1S/C21H31I/c1-2-3-4-7-18-10-12-19(13-11-18)8-5-6-9-20-14-16-21(22)17-15-20/h5,8,14-19H,2-4,6-7,9-13H2,1H3 |
| InChIKey | KZOZENMFKXNGRV-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|