C37H54O3 — CID 67912868
[4-[2-[4-[(E)-hept-1-enyl]cyclohexyl]ethyl]phenyl] 4-[(6S)-6-methyloctoxy]benzoate (PubChem CID 67912868) has the molecular formula C37H54O3 and a molecular weight of 546.84 g/mol. Its IUPAC name is [4-[2-[4-[(E)-hept-1-enyl]cyclohexyl]ethyl]phenyl] 4-[(6S)-6-methyloctoxy]benzoate.
| Compound Name | [4-[2-[4-[(E)-hept-1-enyl]cyclohexyl]ethyl]phenyl] 4-[(6S)-6-methyloctoxy]benzoate |
|---|---|
| PubChem CID | 67912868 |
| Molecular Formula | C37H54O3 |
| Molecular Weight | 546.84 g/mol |
| Exact Mass | 546.41 |
| IUPAC Name | [4-[2-[4-[(E)-hept-1-enyl]cyclohexyl]ethyl]phenyl] 4-[(6S)-6-methyloctoxy]benzoate |
| SMILES | CCCCC/C=C/C1CCC(CCc2ccc(OC(=O)c3ccc(OCCCCC[C@@H](C)CC)cc3)cc2)CC1 |
| InChI | InChI=1S/C37H54O3/c1-4-6-7-8-11-14-31-15-17-32(18-16-31)19-20-33-21-25-36(26-22-33)40-37(38)34-23-27-35(28-24-34)39-29-12-9-10-13-30(3)5-2/h11,14,21-28,30-32H,4-10,12-13,15-20,29H2,1-3H3/b14-11+/t30-,31?,32?/m0/s1 |
| InChIKey | QLHQQJOVFOHTSI-NFWOABLYSA-N |
| XLogP | 10.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.84 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|