C31H42O3 — CID 54218988
[4-[2-(4-prop-2-enylcyclohexyl)ethyl]phenyl] 4-[(4S)-4-methylhexoxy]benzoate (PubChem CID 54218988) has the molecular formula C31H42O3 and a molecular weight of 462.67 g/mol. Its IUPAC name is [4-[2-(4-prop-2-enylcyclohexyl)ethyl]phenyl] 4-[(4S)-4-methylhexoxy]benzoate.
| Compound Name | [4-[2-(4-prop-2-enylcyclohexyl)ethyl]phenyl] 4-[(4S)-4-methylhexoxy]benzoate |
|---|---|
| PubChem CID | 54218988 |
| Molecular Formula | C31H42O3 |
| Molecular Weight | 462.67 g/mol |
| Exact Mass | 462.31 |
| IUPAC Name | [4-[2-(4-prop-2-enylcyclohexyl)ethyl]phenyl] 4-[(4S)-4-methylhexoxy]benzoate |
| SMILES | C=CCC1CCC(CCc2ccc(OC(=O)c3ccc(OCCC[C@@H](C)CC)cc3)cc2)CC1 |
| InChI | InChI=1S/C31H42O3/c1-4-7-25-9-11-26(12-10-25)13-14-27-15-19-30(20-16-27)34-31(32)28-17-21-29(22-18-28)33-23-6-8-24(3)5-2/h4,15-22,24-26H,1,5-14,23H2,2-3H3/t24-,25?,26?/m0/s1 |
| InChIKey | QBEJHFJEHBKWBT-IHSPPPAMSA-N |
| XLogP | 8.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.67 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|