C35H50O4 — CID 67946240
[4-[(E)-3-(4-pentylcyclohexyl)prop-2-enoxy]phenyl] 4-octoxybenzoate (PubChem CID 67946240) has the molecular formula C35H50O4 and a molecular weight of 534.78 g/mol. Its IUPAC name is [4-[(E)-3-(4-pentylcyclohexyl)prop-2-enoxy]phenyl] 4-octoxybenzoate.
| Compound Name | [4-[(E)-3-(4-pentylcyclohexyl)prop-2-enoxy]phenyl] 4-octoxybenzoate |
|---|---|
| PubChem CID | 67946240 |
| Molecular Formula | C35H50O4 |
| Molecular Weight | 534.78 g/mol |
| Exact Mass | 534.37 |
| IUPAC Name | [4-[(E)-3-(4-pentylcyclohexyl)prop-2-enoxy]phenyl] 4-octoxybenzoate |
| SMILES | CCCCCCCCOc1ccc(C(=O)Oc2ccc(OC/C=C/C3CCC(CCCCC)CC3)cc2)cc1 |
| InChI | InChI=1S/C35H50O4/c1-3-5-7-8-9-11-27-37-32-21-19-31(20-22-32)35(36)39-34-25-23-33(24-26-34)38-28-12-14-30-17-15-29(16-18-30)13-10-6-4-2/h12,14,19-26,29-30H,3-11,13,15-18,27-28H2,1-2H3/b14-12+ |
| InChIKey | DWSQRAUHGKBQJO-WYMLVPIESA-N |
| XLogP | 9.97 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.78 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|