C34H46O5 — CID 54220807
[4-(4-hex-5-enylcyclohexanecarbonyl)oxyphenyl] 4-octoxybenzoate (PubChem CID 54220807) has the molecular formula C34H46O5 and a molecular weight of 534.74 g/mol. Its IUPAC name is [4-(4-hex-5-enylcyclohexanecarbonyl)oxyphenyl] 4-octoxybenzoate.
| Compound Name | [4-(4-hex-5-enylcyclohexanecarbonyl)oxyphenyl] 4-octoxybenzoate |
|---|---|
| PubChem CID | 54220807 |
| Molecular Formula | C34H46O5 |
| Molecular Weight | 534.74 g/mol |
| Exact Mass | 534.33 |
| IUPAC Name | [4-(4-hex-5-enylcyclohexanecarbonyl)oxyphenyl] 4-octoxybenzoate |
| SMILES | C=CCCCCC1CCC(C(=O)Oc2ccc(OC(=O)c3ccc(OCCCCCCCC)cc3)cc2)CC1 |
| InChI | InChI=1S/C34H46O5/c1-3-5-7-9-10-12-26-37-30-20-18-29(19-21-30)34(36)39-32-24-22-31(23-25-32)38-33(35)28-16-14-27(15-17-28)13-11-8-6-4-2/h4,18-25,27-28H,2-3,5-17,26H2,1H3 |
| InChIKey | QCLOSAHOAAEZKO-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.74 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|