C22H32O3 — CID 135128347
(4-oct-7-enoxyphenyl) 4-methylcyclohexane-1-carboxylate (PubChem CID 135128347) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is (4-oct-7-enoxyphenyl) 4-methylcyclohexane-1-carboxylate.
| Compound Name | (4-oct-7-enoxyphenyl) 4-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 135128347 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (4-oct-7-enoxyphenyl) 4-methylcyclohexane-1-carboxylate |
| SMILES | C=CCCCCCCOc1ccc(OC(=O)C2CCC(C)CC2)cc1 |
| InChI | InChI=1S/C22H32O3/c1-3-4-5-6-7-8-17-24-20-13-15-21(16-14-20)25-22(23)19-11-9-18(2)10-12-19/h3,13-16,18-19H,1,4-12,17H2,2H3 |
| InChIKey | BVIYDOUMVJVAEP-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|