C24H34O2 — CID 141222555
(4-prop-2-enylphenyl) 4-oct-7-enylcyclohexane-1-carboxylate (PubChem CID 141222555) has the molecular formula C24H34O2 and a molecular weight of 354.53 g/mol. Its IUPAC name is (4-prop-2-enylphenyl) 4-oct-7-enylcyclohexane-1-carboxylate.
| Compound Name | (4-prop-2-enylphenyl) 4-oct-7-enylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 141222555 |
| Molecular Formula | C24H34O2 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | (4-prop-2-enylphenyl) 4-oct-7-enylcyclohexane-1-carboxylate |
| SMILES | C=CCCCCCCC1CCC(C(=O)Oc2ccc(CC=C)cc2)CC1 |
| InChI | InChI=1S/C24H34O2/c1-3-5-6-7-8-9-11-21-12-16-22(17-13-21)24(25)26-23-18-14-20(10-4-2)15-19-23/h3-4,14-15,18-19,21-22H,1-2,5-13,16-17H2 |
| InChIKey | XCAXSDLIODNJPO-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|