C27H38O6 — CID 121288900
4-[4-(2-undec-10-enoyloxyethyl)phenoxy]carbonylcyclohexane-1-carboxylic acid (PubChem CID 121288900) has the molecular formula C27H38O6 and a molecular weight of 458.60 g/mol. Its IUPAC name is 4-[4-(2-undec-10-enoyloxyethyl)phenoxy]carbonylcyclohexane-1-carboxylic acid.
| Compound Name | 4-[4-(2-undec-10-enoyloxyethyl)phenoxy]carbonylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 121288900 |
| Molecular Formula | C27H38O6 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | 4-[4-(2-undec-10-enoyloxyethyl)phenoxy]carbonylcyclohexane-1-carboxylic acid |
| SMILES | C=CCCCCCCCCC(=O)OCCc1ccc(OC(=O)C2CCC(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C27H38O6/c1-2-3-4-5-6-7-8-9-10-25(28)32-20-19-21-11-17-24(18-12-21)33-27(31)23-15-13-22(14-16-23)26(29)30/h2,11-12,17-18,22-23H,1,3-10,13-16,19-20H2,(H,29,30) |
| InChIKey | FOHRMYFDGAGDOC-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|