C23H32O2 — CID 141222562
(4-hept-6-enylcyclohexyl) 4-prop-2-enylbenzoate (PubChem CID 141222562) has the molecular formula C23H32O2 and a molecular weight of 340.51 g/mol. Its IUPAC name is (4-hept-6-enylcyclohexyl) 4-prop-2-enylbenzoate.
| Compound Name | (4-hept-6-enylcyclohexyl) 4-prop-2-enylbenzoate |
|---|---|
| PubChem CID | 141222562 |
| Molecular Formula | C23H32O2 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | (4-hept-6-enylcyclohexyl) 4-prop-2-enylbenzoate |
| SMILES | C=CCCCCCC1CCC(OC(=O)c2ccc(CC=C)cc2)CC1 |
| InChI | InChI=1S/C23H32O2/c1-3-5-6-7-8-10-20-13-17-22(18-14-20)25-23(24)21-15-11-19(9-4-2)12-16-21/h3-4,11-12,15-16,20,22H,1-2,5-10,13-14,17-18H2 |
| InChIKey | CTTRAJRNIWXADY-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|