About (4-hept-6-enylcyclohexyl) 4-prop-2-enylbenzoate
(4-hept-6-enylcyclohexyl) 4-prop-2-enylbenzoate (PubChem CID 141222562) has the molecular formula C23H32O2
and a molecular weight of 340.51 g/mol. Its IUPAC name is (4-hept-6-enylcyclohexyl) 4-prop-2-enylbenzoate.
Molecular Properties
| Compound Name | (4-hept-6-enylcyclohexyl) 4-prop-2-enylbenzoate |
| PubChem CID | 141222562 |
| Molecular Formula | C23H32O2 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | (4-hept-6-enylcyclohexyl) 4-prop-2-enylbenzoate |
| SMILES | C=CCCCCCC1CCC(OC(=O)c2ccc(CC=C)cc2)CC1 |
| InChI | InChI=1S/C23H32O2/c1-3-5-6-7-8-10-20-13-17-22(18-14-20)25-23(24)21-15-11-19(9-4-2)12-16-21/h3-4,11-12,15-16,20,22H,1-2,5-10,13-14,17-18H2 |
| InChIKey | CTTRAJRNIWXADY-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4-hept-6-enylcyclohexyl) 4-prop-2-enylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hept-6-enylcyclohexyl) 4-prop-2-enylbenzoate?
The IUPAC name of (4-hept-6-enylcyclohexyl) 4-prop-2-enylbenzoate (CID 141222562) is (4-hept-6-enylcyclohexyl) 4-prop-2-enylbenzoate.
What is the SMILES notation for (4-hept-6-enylcyclohexyl) 4-prop-2-enylbenzoate?
The canonical SMILES for (4-hept-6-enylcyclohexyl) 4-prop-2-enylbenzoate is C=CCCCCCC1CCC(OC(=O)c2ccc(CC=C)cc2)CC1.
What is the InChIKey of (4-hept-6-enylcyclohexyl) 4-prop-2-enylbenzoate?
The InChIKey is CTTRAJRNIWXADY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H32O2/c1-3-5-6-7-8-10-20-13-17-22(18-14-20)25-23(24)21-15-11-19(9-4-2)12-16-21/h3-4,11-12,15-16,20,22H,1-2,5-10,13-14,17-18H2.
What are the key properties of (4-hept-6-enylcyclohexyl) 4-prop-2-enylbenzoate?
(4-hept-6-enylcyclohexyl) 4-prop-2-enylbenzoate has a molecular weight of 340.51 g/mol, XLogP of 6.27, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hept-6-enylcyclohexyl) 4-prop-2-enylbenzoate is sourced from PubChem (CID 141222562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).