C34H46O5 — CID 158622052
2-[4-(4-hex-5-enylcyclohexyl)oxycarbonylphenyl]-4-octoxybenzoic acid (PubChem CID 158622052) has the molecular formula C34H46O5 and a molecular weight of 534.74 g/mol. Its IUPAC name is 2-[4-(4-hex-5-enylcyclohexyl)oxycarbonylphenyl]-4-octoxybenzoic acid.
| Compound Name | 2-[4-(4-hex-5-enylcyclohexyl)oxycarbonylphenyl]-4-octoxybenzoic acid |
|---|---|
| PubChem CID | 158622052 |
| Molecular Formula | C34H46O5 |
| Molecular Weight | 534.74 g/mol |
| Exact Mass | 534.33 |
| IUPAC Name | 2-[4-(4-hex-5-enylcyclohexyl)oxycarbonylphenyl]-4-octoxybenzoic acid |
| SMILES | C=CCCCCC1CCC(OC(=O)c2ccc(-c3cc(OCCCCCCCC)ccc3C(=O)O)cc2)CC1 |
| InChI | InChI=1S/C34H46O5/c1-3-5-7-9-10-12-24-38-30-22-23-31(33(35)36)32(25-30)27-16-18-28(19-17-27)34(37)39-29-20-14-26(15-21-29)13-11-8-6-4-2/h4,16-19,22-23,25-26,29H,2-3,5-15,20-21,24H2,1H3,(H,35,36) |
| InChIKey | HYCVUHBSSGVHMH-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.74 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|