C31H44O4 — CID 172717464
4-ethoxy-2-[4-[3-(4-heptylcyclohexyl)propoxy]phenyl]benzoic acid (PubChem CID 172717464) has the molecular formula C31H44O4 and a molecular weight of 480.69 g/mol. Its IUPAC name is 4-ethoxy-2-[4-[3-(4-heptylcyclohexyl)propoxy]phenyl]benzoic acid.
| Compound Name | 4-ethoxy-2-[4-[3-(4-heptylcyclohexyl)propoxy]phenyl]benzoic acid |
|---|---|
| PubChem CID | 172717464 |
| Molecular Formula | C31H44O4 |
| Molecular Weight | 480.69 g/mol |
| Exact Mass | 480.32 |
| IUPAC Name | 4-ethoxy-2-[4-[3-(4-heptylcyclohexyl)propoxy]phenyl]benzoic acid |
| SMILES | CCCCCCCC1CCC(CCCOc2ccc(-c3cc(OCC)ccc3C(=O)O)cc2)CC1 |
| InChI | InChI=1S/C31H44O4/c1-3-5-6-7-8-10-24-12-14-25(15-13-24)11-9-22-35-27-18-16-26(17-19-27)30-23-28(34-4-2)20-21-29(30)31(32)33/h16-21,23-25H,3-15,22H2,1-2H3,(H,32,33) |
| InChIKey | GBDSCMDKIVXYMQ-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.69 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|