C32H52O3 — CID 67791494
4-octoxy-2-[4-(4-pentylcyclohexyl)cyclohexyl]benzoic acid (PubChem CID 67791494) has the molecular formula C32H52O3 and a molecular weight of 484.77 g/mol. Its IUPAC name is 4-octoxy-2-[4-(4-pentylcyclohexyl)cyclohexyl]benzoic acid.
| Compound Name | 4-octoxy-2-[4-(4-pentylcyclohexyl)cyclohexyl]benzoic acid |
|---|---|
| PubChem CID | 67791494 |
| Molecular Formula | C32H52O3 |
| Molecular Weight | 484.77 g/mol |
| Exact Mass | 484.39 |
| IUPAC Name | 4-octoxy-2-[4-(4-pentylcyclohexyl)cyclohexyl]benzoic acid |
| SMILES | CCCCCCCCOc1ccc(C(=O)O)c(C2CCC(C3CCC(CCCCC)CC3)CC2)c1 |
| InChI | InChI=1S/C32H52O3/c1-3-5-7-8-9-11-23-35-29-21-22-30(32(33)34)31(24-29)28-19-17-27(18-20-28)26-15-13-25(14-16-26)12-10-6-4-2/h21-22,24-28H,3-20,23H2,1-2H3,(H,33,34) |
| InChIKey | KPFMDJDYMRCTOP-UHFFFAOYSA-N |
| XLogP | 9.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.77 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|