C39H56O5 — CID 162775623
4-oxo-4-[6-[4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]phenoxy]hexoxy]butanoic acid (PubChem CID 162775623) has the molecular formula C39H56O5 and a molecular weight of 604.87 g/mol. Its IUPAC name is 4-oxo-4-[6-[4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]phenoxy]hexoxy]butanoic acid.
| Compound Name | 4-oxo-4-[6-[4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]phenoxy]hexoxy]butanoic acid |
|---|---|
| PubChem CID | 162775623 |
| Molecular Formula | C39H56O5 |
| Molecular Weight | 604.87 g/mol |
| Exact Mass | 604.41 |
| IUPAC Name | 4-oxo-4-[6-[4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]phenoxy]hexoxy]butanoic acid |
| SMILES | CCCCCC1CCC(C2CCC(c3ccc(-c4ccc(OCCCCCCOC(=O)CCC(=O)O)cc4)cc3)CC2)CC1 |
| InChI | InChI=1S/C39H56O5/c1-2-3-6-9-30-10-12-31(13-11-30)32-14-16-33(17-15-32)34-18-20-35(21-19-34)36-22-24-37(25-23-36)43-28-7-4-5-8-29-44-39(42)27-26-38(40)41/h18-25,30-33H,2-17,26-29H2,1H3,(H,40,41) |
| InChIKey | JOLZSQSANSKXCU-UHFFFAOYSA-N |
| XLogP | 10.36 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.87 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|