C33H52O5 — CID 58019591
6-[4-(4-pentylcyclohexyl)phenoxy]hexyl 6-(2-methylprop-2-enoyloxy)hexanoate (PubChem CID 58019591) has the molecular formula C33H52O5 and a molecular weight of 528.77 g/mol. Its IUPAC name is 6-[4-(4-pentylcyclohexyl)phenoxy]hexyl 6-(2-methylprop-2-enoyloxy)hexanoate.
| Compound Name | 6-[4-(4-pentylcyclohexyl)phenoxy]hexyl 6-(2-methylprop-2-enoyloxy)hexanoate |
|---|---|
| PubChem CID | 58019591 |
| Molecular Formula | C33H52O5 |
| Molecular Weight | 528.77 g/mol |
| Exact Mass | 528.38 |
| IUPAC Name | 6-[4-(4-pentylcyclohexyl)phenoxy]hexyl 6-(2-methylprop-2-enoyloxy)hexanoate |
| SMILES | C=C(C)C(=O)OCCCCCC(=O)OCCCCCCOc1ccc(C2CCC(CCCCC)CC2)cc1 |
| InChI | InChI=1S/C33H52O5/c1-4-5-9-14-28-16-18-29(19-17-28)30-20-22-31(23-21-30)36-24-11-6-7-12-25-37-32(34)15-10-8-13-26-38-33(35)27(2)3/h20-23,28-29H,2,4-19,24-26H2,1,3H3 |
| InChIKey | AQLHXCSOWFPYEW-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.77 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|