C34H52O5 — CID 70389163
4-[6-(2-methylprop-2-enoyloxy)hexoxy]-2-[4-(4-pentylcyclohexyl)cyclohexyl]benzoic acid (PubChem CID 70389163) has the molecular formula C34H52O5 and a molecular weight of 540.79 g/mol. Its IUPAC name is 4-[6-(2-methylprop-2-enoyloxy)hexoxy]-2-[4-(4-pentylcyclohexyl)cyclohexyl]benzoic acid.
| Compound Name | 4-[6-(2-methylprop-2-enoyloxy)hexoxy]-2-[4-(4-pentylcyclohexyl)cyclohexyl]benzoic acid |
|---|---|
| PubChem CID | 70389163 |
| Molecular Formula | C34H52O5 |
| Molecular Weight | 540.79 g/mol |
| Exact Mass | 540.38 |
| IUPAC Name | 4-[6-(2-methylprop-2-enoyloxy)hexoxy]-2-[4-(4-pentylcyclohexyl)cyclohexyl]benzoic acid |
| SMILES | C=C(C)C(=O)OCCCCCCOc1ccc(C(=O)O)c(C2CCC(C3CCC(CCCCC)CC3)CC2)c1 |
| InChI | InChI=1S/C34H52O5/c1-4-5-8-11-26-12-14-27(15-13-26)28-16-18-29(19-17-28)32-24-30(20-21-31(32)33(35)36)38-22-9-6-7-10-23-39-34(37)25(2)3/h20-21,24,26-29H,2,4-19,22-23H2,1,3H3,(H,35,36) |
| InChIKey | JQUCIHSYDBBSOG-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.79 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|